C9H14N4O2 — CID 104535709
2-[[5-(methylamino)-3-pyridinyl]amino]ethyl carbamate (PubChem CID 104535709) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[[5-(methylamino)-3-pyridinyl]amino]ethyl carbamate.
| Compound Name | 2-[[5-(methylamino)-3-pyridinyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 104535709 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[[5-(methylamino)-3-pyridinyl]amino]ethyl carbamate |
| SMILES | CNc1cncc(NCCOC(N)=O)c1 |
| InChI | InChI=1S/C9H14N4O2/c1-11-7-4-8(6-12-5-7)13-2-3-15-9(10)14/h4-6,11,13H,2-3H2,1H3,(H2,10,14) |
| InChIKey | UTYCJNURLOKKCH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|