C12H20N2OS — CID 104536070
N,2,2-trimethyl-3-(1-thiophen-2-ylethylamino)propanamide (PubChem CID 104536070) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(1-thiophen-2-ylethylamino)propanamide.
| Compound Name | N,2,2-trimethyl-3-(1-thiophen-2-ylethylamino)propanamide |
|---|---|
| PubChem CID | 104536070 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N,2,2-trimethyl-3-(1-thiophen-2-ylethylamino)propanamide |
| SMILES | CNC(=O)C(C)(C)CNC(C)c1cccs1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(10-6-5-7-16-10)14-8-12(2,3)11(15)13-4/h5-7,9,14H,8H2,1-4H3,(H,13,15) |
| InChIKey | YLRXGDDVOQBYBG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |