C6H4F4N2O3 — CID 104538280
methyl 5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 104538280) has the molecular formula C6H4F4N2O3 and a molecular weight of 228.10 g/mol. Its IUPAC name is methyl 5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | methyl 5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 104538280 |
| Molecular Formula | C6H4F4N2O3 |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | methyl 5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | COC(=O)c1nnc(C(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C6H4F4N2O3/c1-14-3(13)2-11-12-5(15-2)6(9,10)4(7)8/h4H,1H3 |
| InChIKey | GXNSKZVPNGWYDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|