methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate

C9H12N2O3 — CID 104538284

IUPACmethyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(CC2CCC2)o1
InChIInChI=1S/C9H12N2O3/c1-13-9(12)8-11-10-7(14-8)5-6-3-2-4-6/h6H,2-5H2,1H3
InChIKeyFXERTKFVMLWIRQ-UHFFFAOYSA-N
MW196.21 g/mol
LogP1.20
Rot. Bonds3

About methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate

methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 104538284) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate
PubChem CID104538284
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Namemethyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(CC2CCC2)o1
InChIInChI=1S/C9H12N2O3/c1-13-9(12)8-11-10-7(14-8)5-6-3-2-4-6/h6H,2-5H2,1H3
InChIKeyFXERTKFVMLWIRQ-UHFFFAOYSA-N
XLogP1.20
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 51.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate (CID 104538284) is methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(CC2CCC2)o1.
What is the InChIKey of methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is FXERTKFVMLWIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-13-9(12)8-11-10-7(14-8)5-6-3-2-4-6/h6H,2-5H2,1H3.
What are the key properties of methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate?
methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 196.21 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(cyclobutylmethyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 104538284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).