About ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate
ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 104538345) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 104538345 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCCCCCc1nnc(C(=O)OCC)o1 |
| InChI | InChI=1S/C11H18N2O3/c1-3-5-6-7-8-9-12-13-10(16-9)11(14)15-4-2/h3-8H2,1-2H3 |
| InChIKey | JKUDMELQDWQYKO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate (CID 104538345) is ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate is CCCCCCc1nnc(C(=O)OCC)o1.
What is the InChIKey of ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is JKUDMELQDWQYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-3-5-6-7-8-9-12-13-10(16-9)11(14)15-4-2/h3-8H2,1-2H3.
What are the key properties of ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate?
ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 226.28 g/mol, XLogP of 2.37, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hexyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 104538345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).