C13H13Br2N3O2 — CID 104538602
5-[1-(2,4-dibromophenyl)triazol-4-yl]pentanoic acid (PubChem CID 104538602) has the molecular formula C13H13Br2N3O2 and a molecular weight of 403.07 g/mol. Its IUPAC name is 5-[1-(2,4-dibromophenyl)triazol-4-yl]pentanoic acid.
| Compound Name | 5-[1-(2,4-dibromophenyl)triazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 104538602 |
| Molecular Formula | C13H13Br2N3O2 |
| Molecular Weight | 403.07 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | 5-[1-(2,4-dibromophenyl)triazol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cn(-c2ccc(Br)cc2Br)nn1 |
| InChI | InChI=1S/C13H13Br2N3O2/c14-9-5-6-12(11(15)7-9)18-8-10(16-17-18)3-1-2-4-13(19)20/h5-8H,1-4H2,(H,19,20) |
| InChIKey | DHGQMIRPOPAVOK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|