C22H26Cl2N2O — CID 10453927
5-[2-(3,4-dichlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 10453927) has the molecular formula C22H26Cl2N2O and a molecular weight of 405.37 g/mol. Its IUPAC name is 5-[2-(3,4-dichlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 5-[2-(3,4-dichlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 10453927 |
| Molecular Formula | C22H26Cl2N2O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-[2-(3,4-dichlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CC(C)=CCn1c2c(ccc1=O)C(NCCc1ccc(Cl)c(Cl)c1)CCC2 |
| InChI | InChI=1S/C22H26Cl2N2O/c1-15(2)11-13-26-21-5-3-4-20(17(21)7-9-22(26)27)25-12-10-16-6-8-18(23)19(24)14-16/h6-9,11,14,20,25H,3-5,10,12-13H2,1-2H3 |
| InChIKey | FSEPICGAYWCPQD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|