C23H30N6O — CID 10454027
10-[2-(dimethylamino)ethylamino]-14-[[2-(dimethylamino)ethylamino]methyl]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one (PubChem CID 10454027) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 10-[2-(dimethylamino)ethylamino]-14-[[2-(dimethylamino)ethylamino]methyl]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one.
| Compound Name | 10-[2-(dimethylamino)ethylamino]-14-[[2-(dimethylamino)ethylamino]methyl]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 10454027 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 10-[2-(dimethylamino)ethylamino]-14-[[2-(dimethylamino)ethylamino]methyl]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
| SMILES | CN(C)CCNCc1nn2c3ccccc3c(=O)c3c(NCCN(C)C)ccc1c32 |
| InChI | InChI=1S/C23H30N6O/c1-27(2)13-11-24-15-19-16-9-10-18(25-12-14-28(3)4)21-22(16)29(26-19)20-8-6-5-7-17(20)23(21)30/h5-10,24-25H,11-15H2,1-4H3 |
| InChIKey | MRPMEJHBODPYGL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|