C21H28O8 — CID 10454124
[(2R,3R,4R,5R,6R)-3-acetyloxy-5,6-diethoxy-8-oxo-2-phenyloxocan-4-yl] acetate (PubChem CID 10454124) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3-acetyloxy-5,6-diethoxy-8-oxo-2-phenyloxocan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3-acetyloxy-5,6-diethoxy-8-oxo-2-phenyloxocan-4-yl] acetate |
|---|---|
| PubChem CID | 10454124 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3-acetyloxy-5,6-diethoxy-8-oxo-2-phenyloxocan-4-yl] acetate |
| SMILES | CCO[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](c2ccccc2)OC(=O)C[C@H]1OCC |
| InChI | InChI=1S/C21H28O8/c1-5-25-16-12-17(24)29-18(15-10-8-7-9-11-15)20(27-13(3)22)21(28-14(4)23)19(16)26-6-2/h7-11,16,18-21H,5-6,12H2,1-4H3/t16-,18-,19-,20-,21-/m1/s1 |
| InChIKey | AGPVKYQQAJPEGH-GHRYLNIYSA-N |
| XLogP | 2.35 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|