C21H19N5O3S — CID 1045419
N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 1045419) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 1045419 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | C[C@H]1CCc2c(sc3ncn(CC(=O)/N=N/c4c(O)[nH]c5ccccc45)c(=O)c23)C1 |
| InChI | InChI=1S/C21H19N5O3S/c1-11-6-7-13-15(8-11)30-20-17(13)21(29)26(10-22-20)9-16(27)24-25-18-12-4-2-3-5-14(12)23-19(18)28/h2-5,10-11,23,28H,6-9H2,1H3/b25-24+/t11-/m0/s1 |
| InChIKey | FDXCBMAWQBWMPV-AOITYGGZSA-N |
| XLogP | 4.08 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|