About 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea
1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea (PubChem CID 10454303) has the molecular formula C26H25N3O2
and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea |
| PubChem CID | 10454303 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2c(-c3ccccc3)c3cc(C)c(C)cc3c(=O)n2C)c1 |
| InChI | InChI=1S/C26H25N3O2/c1-16-9-8-12-20(13-16)27-26(31)28-24-23(19-10-6-5-7-11-19)21-14-17(2)18(3)15-22(21)25(30)29(24)4/h5-15H,1-4H3,(H2,27,28,31) |
| InChIKey | HPSOFZODPZQTAH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea?
The IUPAC name of 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea (CID 10454303) is 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea.
What is the SMILES notation for 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea?
The canonical SMILES for 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea is Cc1cccc(NC(=O)Nc2c(-c3ccccc3)c3cc(C)c(C)cc3c(=O)n2C)c1.
What is the InChIKey of 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea?
The InChIKey is HPSOFZODPZQTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O2/c1-16-9-8-12-20(13-16)27-26(31)28-24-23(19-10-6-5-7-11-19)21-14-17(2)18(3)15-22(21)25(30)29(24)4/h5-15H,1-4H3,(H2,27,28,31).
What are the key properties of 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea?
1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea has a molecular weight of 411.51 g/mol, XLogP of 5.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylphenyl)-3-(2,6,7-trimethyl-1-oxo-4-phenylisoquinolin-3-yl)urea is sourced from PubChem (CID 10454303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).