C14H18BrClO — CID 104543990
7-(1-bromo-3,3-dimethylbutyl)-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 104543990) has the molecular formula C14H18BrClO and a molecular weight of 317.65 g/mol. Its IUPAC name is 7-(1-bromo-3,3-dimethylbutyl)-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-(1-bromo-3,3-dimethylbutyl)-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543990 |
| Molecular Formula | C14H18BrClO |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 7-(1-bromo-3,3-dimethylbutyl)-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)(C)CC(Br)c1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C14H18BrClO/c1-14(2,3)8-12(15)11-7-10(16)6-9-4-5-17-13(9)11/h6-7,12H,4-5,8H2,1-3H3 |
| InChIKey | QPPRKARPIUYPHG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|