C14H18FNO — CID 104545402
4-[2,3-dihydro-1-benzofuran-5-yl(fluoro)methyl]piperidine (PubChem CID 104545402) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 4-[2,3-dihydro-1-benzofuran-5-yl(fluoro)methyl]piperidine.
| Compound Name | 4-[2,3-dihydro-1-benzofuran-5-yl(fluoro)methyl]piperidine |
|---|---|
| PubChem CID | 104545402 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-[2,3-dihydro-1-benzofuran-5-yl(fluoro)methyl]piperidine |
| SMILES | FC(c1ccc2c(c1)CCO2)C1CCNCC1 |
| InChI | InChI=1S/C14H18FNO/c15-14(10-3-6-16-7-4-10)12-1-2-13-11(9-12)5-8-17-13/h1-2,9-10,14,16H,3-8H2 |
| InChIKey | HNCQUKBTQWXCAP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |