C13H19ClO2 — CID 104546198
1-(5-chloro-2-methoxyphenyl)-2,3-dimethylbutan-1-ol (PubChem CID 104546198) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 104546198 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2,3-dimethylbutan-1-ol |
| SMILES | COc1ccc(Cl)cc1C(O)C(C)C(C)C |
| InChI | InChI=1S/C13H19ClO2/c1-8(2)9(3)13(15)11-7-10(14)5-6-12(11)16-4/h5-9,13,15H,1-4H3 |
| InChIKey | NNQZIUWHXJVZOD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |