C10H16N2O3 — CID 104546739
2-[(5-methyl-1,3-oxazol-2-yl)methylamino]pentanoic acid (PubChem CID 104546739) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-oxazol-2-yl)methylamino]pentanoic acid.
| Compound Name | 2-[(5-methyl-1,3-oxazol-2-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 104546739 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[(5-methyl-1,3-oxazol-2-yl)methylamino]pentanoic acid |
| SMILES | CCCC(NCc1ncc(C)o1)C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-3-4-8(10(13)14)11-6-9-12-5-7(2)15-9/h5,8,11H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | WYTFKWAOROCVRA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |