C14H23N3O — CID 104547950
N-methyl-N,2-bis[2-(methylamino)ethyl]benzamide (PubChem CID 104547950) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-methyl-N,2-bis[2-(methylamino)ethyl]benzamide.
| Compound Name | N-methyl-N,2-bis[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 104547950 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-methyl-N,2-bis[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCc1ccccc1C(=O)N(C)CCNC |
| InChI | InChI=1S/C14H23N3O/c1-15-9-8-12-6-4-5-7-13(12)14(18)17(3)11-10-16-2/h4-7,15-16H,8-11H2,1-3H3 |
| InChIKey | DSHPBGDMFPSVGE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |