About (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate
(4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate (PubChem CID 10454850) has the molecular formula C20H21F2N3O5
and a molecular weight of 421.40 g/mol. Its IUPAC name is (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate |
| PubChem CID | 10454850 |
| Molecular Formula | C20H21F2N3O5 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate |
| SMILES | CC(c1ccc(F)c(F)c1)N1CCO[C@@H](CNC(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H21F2N3O5/c1-13(14-2-7-18(21)19(22)10-14)24-8-9-29-17(12-24)11-23-20(26)30-16-5-3-15(4-6-16)25(27)28/h2-7,10,13,17H,8-9,11-12H2,1H3,(H,23,26)/t13?,17-/m0/s1 |
| InChIKey | HIMWHLGWENNHOO-RUINGEJQSA-N |
| XLogP | 3.42 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate?
The IUPAC name of (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate (CID 10454850) is (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate.
What is the SMILES notation for (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate?
The canonical SMILES for (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate is CC(c1ccc(F)c(F)c1)N1CCO[C@@H](CNC(=O)Oc2ccc([N+](=O)[O-])cc2)C1.
What is the InChIKey of (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate?
The InChIKey is HIMWHLGWENNHOO-RUINGEJQSA-N. The full InChI is InChI=1S/C20H21F2N3O5/c1-13(14-2-7-18(21)19(22)10-14)24-8-9-29-17(12-24)11-23-20(26)30-16-5-3-15(4-6-16)25(27)28/h2-7,10,13,17H,8-9,11-12H2,1H3,(H,23,26)/t13?,17-/m0/s1.
What are the key properties of (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate?
(4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate has a molecular weight of 421.40 g/mol, XLogP of 3.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) N-[[(2S)-4-[1-(3,4-difluorophenyl)ethyl]morpholin-2-yl]methyl]carbamate is sourced from PubChem (CID 10454850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).