C15H22N2O3S — CID 104548618
2-[2-[methyl(3-methylsulfanylpropylcarbamoyl)amino]ethyl]benzoic acid (PubChem CID 104548618) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[2-[methyl(3-methylsulfanylpropylcarbamoyl)amino]ethyl]benzoic acid.
| Compound Name | 2-[2-[methyl(3-methylsulfanylpropylcarbamoyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 104548618 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[2-[methyl(3-methylsulfanylpropylcarbamoyl)amino]ethyl]benzoic acid |
| SMILES | CSCCCNC(=O)N(C)CCc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H22N2O3S/c1-17(15(20)16-9-5-11-21-2)10-8-12-6-3-4-7-13(12)14(18)19/h3-4,6-7H,5,8-11H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | QVHRBZITTQYZEJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|