About 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol
2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol (PubChem CID 104549066) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol |
| PubChem CID | 104549066 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol |
| SMILES | CC1CN(C(C)(C)CO)S(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO3S/c1-7-4-9(8(2,3)6-10)13(11,12)5-7/h7,10H,4-6H2,1-3H3 |
| InChIKey | MHJQMABAMZQYJM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol?
The IUPAC name of 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol (CID 104549066) is 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol.
What is the SMILES notation for 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol?
The canonical SMILES for 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol is CC1CN(C(C)(C)CO)S(=O)(=O)C1.
What is the InChIKey of 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol?
The InChIKey is MHJQMABAMZQYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S/c1-7-4-9(8(2,3)6-10)13(11,12)5-7/h7,10H,4-6H2,1-3H3.
What are the key properties of 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol?
2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol has a molecular weight of 207.29 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propan-1-ol is sourced from PubChem (CID 104549066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).