C19H35FN2O5S — CID 10454941
(2S)-4-butyl-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide (PubChem CID 10454941) has the molecular formula C19H35FN2O5S and a molecular weight of 422.56 g/mol. Its IUPAC name is (2S)-4-butyl-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-butyl-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10454941 |
| Molecular Formula | C19H35FN2O5S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2S)-4-butyl-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCC1(F)CN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C19H35FN2O5S/c1-5-6-7-19(20)8-11(21-9-19)17(26)22-12(10(2)3)16-14(24)13(23)15(25)18(27-16)28-4/h10-16,18,21,23-25H,5-9H2,1-4H3,(H,22,26)/t11-,12+,13-,14+,15+,16+,18+,19?/m0/s1 |
| InChIKey | HXKQQDMDSRNRJP-PYIZGVIUSA-N |
| XLogP | 0.56 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |