C11H15NO3S — CID 104549561
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylethanol (PubChem CID 104549561) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylethanol.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylethanol |
|---|---|
| PubChem CID | 104549561 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-phenylethanol |
| SMILES | O=S1(=O)CCCN1C(CO)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3S/c13-9-11(10-5-2-1-3-6-10)12-7-4-8-16(12,14)15/h1-3,5-6,11,13H,4,7-9H2 |
| InChIKey | KEFQGZAJFPJWHA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |