About 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol
2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol (PubChem CID 104550149) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol |
| PubChem CID | 104550149 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol |
| SMILES | OC1CCCC1CN1CC=CC1 |
| InChI | InChI=1S/C10H17NO/c12-10-5-3-4-9(10)8-11-6-1-2-7-11/h1-2,9-10,12H,3-8H2 |
| InChIKey | YHYOFTRWTKFTBL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol?
The IUPAC name of 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol (CID 104550149) is 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol.
What is the SMILES notation for 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol?
The canonical SMILES for 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol is OC1CCCC1CN1CC=CC1.
What is the InChIKey of 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol?
The InChIKey is YHYOFTRWTKFTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c12-10-5-3-4-9(10)8-11-6-1-2-7-11/h1-2,9-10,12H,3-8H2.
What are the key properties of 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol?
2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydropyrrol-1-ylmethyl)cyclopentan-1-ol is sourced from PubChem (CID 104550149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).