About [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol
[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol (PubChem CID 104550224) has the molecular formula C11H21NO3S
and a molecular weight of 247.36 g/mol. Its IUPAC name is [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol |
| PubChem CID | 104550224 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol |
| SMILES | O=S1(=O)CCCN1CC1CCCCC1CO |
| InChI | InChI=1S/C11H21NO3S/c13-9-11-5-2-1-4-10(11)8-12-6-3-7-16(12,14)15/h10-11,13H,1-9H2 |
| InChIKey | LQEMGVBMJOSNHX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol?
The IUPAC name of [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol (CID 104550224) is [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol.
What is the SMILES notation for [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol?
The canonical SMILES for [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol is O=S1(=O)CCCN1CC1CCCCC1CO.
What is the InChIKey of [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol?
The InChIKey is LQEMGVBMJOSNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3S/c13-9-11-5-2-1-4-10(11)8-12-6-3-7-16(12,14)15/h10-11,13H,1-9H2.
What are the key properties of [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol?
[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol has a molecular weight of 247.36 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclohexyl]methanol is sourced from PubChem (CID 104550224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).