About [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate
[(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate (PubChem CID 10455046) has the molecular formula C22H36O6Si
and a molecular weight of 424.61 g/mol. Its IUPAC name is [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate.
Molecular Properties
| Compound Name | [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate |
| PubChem CID | 10455046 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate |
| SMILES | CCCC/C=C/O[Si](OCC[C@@H](C)OC(=O)c1cccoc1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H36O6Si/c1-7-8-9-10-15-26-29(17(2)3,18(4)5)27-16-13-19(6)28-22(24)20-12-11-14-25-21(20)23/h10-12,14-15,17-19H,7-9,13,16H2,1-6H3/b15-10+/t19-/m1/s1 |
| InChIKey | KSMMBAHYVULVQP-JVVYVMHDSA-N |
| XLogP | 5.57 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The IUPAC name of [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate (CID 10455046) is [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate.
What is the SMILES notation for [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The canonical SMILES for [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate is CCCC/C=C/O[Si](OCC[C@@H](C)OC(=O)c1cccoc1=O)(C(C)C)C(C)C.
What is the InChIKey of [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The InChIKey is KSMMBAHYVULVQP-JVVYVMHDSA-N. The full InChI is InChI=1S/C22H36O6Si/c1-7-8-9-10-15-26-29(17(2)3,18(4)5)27-16-13-19(6)28-22(24)20-12-11-14-25-21(20)23/h10-12,14-15,17-19H,7-9,13,16H2,1-6H3/b15-10+/t19-/m1/s1.
What are the key properties of [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
[(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate has a molecular weight of 424.61 g/mol, XLogP of 5.57, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-[[(E)-hex-1-enoxy]-di(propan-2-yl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate is sourced from PubChem (CID 10455046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).