About [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol
[1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol (PubChem CID 104550683) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol |
| PubChem CID | 104550683 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol |
| SMILES | CC1(C)CN(CC2(CO)CC2)C1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)5-11(6-9)7-10(8-12)3-4-10/h12H,3-8H2,1-2H3 |
| InChIKey | FYNWDCCZPABLFK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol?
The IUPAC name of [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol (CID 104550683) is [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol.
What is the SMILES notation for [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol?
The canonical SMILES for [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol is CC1(C)CN(CC2(CO)CC2)C1.
What is the InChIKey of [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol?
The InChIKey is FYNWDCCZPABLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2)5-11(6-9)7-10(8-12)3-4-10/h12H,3-8H2,1-2H3.
What are the key properties of [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol?
[1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol has a molecular weight of 169.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,3-dimethylazetidin-1-yl)methyl]cyclopropyl]methanol is sourced from PubChem (CID 104550683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).