C13H27NO2 — CID 104550734
2-(3,3-dipropylazetidin-1-yl)-2-methylpropane-1,3-diol (PubChem CID 104550734) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(3,3-dipropylazetidin-1-yl)-2-methylpropane-1,3-diol.
| Compound Name | 2-(3,3-dipropylazetidin-1-yl)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 104550734 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(3,3-dipropylazetidin-1-yl)-2-methylpropane-1,3-diol |
| SMILES | CCCC1(CCC)CN(C(C)(CO)CO)C1 |
| InChI | InChI=1S/C13H27NO2/c1-4-6-13(7-5-2)8-14(9-13)12(3,10-15)11-16/h15-16H,4-11H2,1-3H3 |
| InChIKey | OYYAKJZNGSIMMY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |