About 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol
2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol (PubChem CID 104551141) has the molecular formula C9H18N4O
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol |
| PubChem CID | 104551141 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol |
| SMILES | Cc1nn(C)c(N(C)C(C)CO)c1N |
| InChI | InChI=1S/C9H18N4O/c1-6(5-14)12(3)9-8(10)7(2)11-13(9)4/h6,14H,5,10H2,1-4H3 |
| InChIKey | VLMSSUTUIBHTFB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol?
The IUPAC name of 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol (CID 104551141) is 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol.
What is the SMILES notation for 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol?
The canonical SMILES for 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol is Cc1nn(C)c(N(C)C(C)CO)c1N.
What is the InChIKey of 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol?
The InChIKey is VLMSSUTUIBHTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O/c1-6(5-14)12(3)9-8(10)7(2)11-13(9)4/h6,14H,5,10H2,1-4H3.
What are the key properties of 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol?
2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol has a molecular weight of 198.27 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,3-dimethylpyrazol-5-yl)-methylamino]propan-1-ol is sourced from PubChem (CID 104551141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).