About 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile
2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile (PubChem CID 10455159) has the molecular formula C26H26N4O2
and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile.
Molecular Properties
| Compound Name | 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile |
| PubChem CID | 10455159 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile |
| SMILES | N#CC(c1ccncc1)N1CCN(C(=O)CC(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N4O2/c27-20-24(21-11-13-28-14-12-21)29-15-17-30(18-16-29)25(31)19-26(32,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,24,32H,15-19H2 |
| InChIKey | FQQHZKLGYQTVQN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile?
The IUPAC name of 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile (CID 10455159) is 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile.
What is the SMILES notation for 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile?
The canonical SMILES for 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile is N#CC(c1ccncc1)N1CCN(C(=O)CC(O)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile?
The InChIKey is FQQHZKLGYQTVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2/c27-20-24(21-11-13-28-14-12-21)29-15-17-30(18-16-29)25(31)19-26(32,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,24,32H,15-19H2.
What are the key properties of 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile?
2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile has a molecular weight of 426.52 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-hydroxy-3,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-4-ylacetonitrile is sourced from PubChem (CID 10455159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).