C14H23ClN2O — CID 104552335
2-[3-chloro-4-[1-(ethylamino)ethyl]-N-methylanilino]propan-1-ol (PubChem CID 104552335) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-[3-chloro-4-[1-(ethylamino)ethyl]-N-methylanilino]propan-1-ol.
| Compound Name | 2-[3-chloro-4-[1-(ethylamino)ethyl]-N-methylanilino]propan-1-ol |
|---|---|
| PubChem CID | 104552335 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[3-chloro-4-[1-(ethylamino)ethyl]-N-methylanilino]propan-1-ol |
| SMILES | CCNC(C)c1ccc(N(C)C(C)CO)cc1Cl |
| InChI | InChI=1S/C14H23ClN2O/c1-5-16-11(3)13-7-6-12(8-14(13)15)17(4)10(2)9-18/h6-8,10-11,16,18H,5,9H2,1-4H3 |
| InChIKey | ICQSLTLGFOQAPA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|