C9H19NO3 — CID 104552508
methyl 3-[1-hydroxypropan-2-yl(methyl)amino]-2-methylpropanoate (PubChem CID 104552508) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is methyl 3-[1-hydroxypropan-2-yl(methyl)amino]-2-methylpropanoate.
| Compound Name | methyl 3-[1-hydroxypropan-2-yl(methyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 104552508 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | methyl 3-[1-hydroxypropan-2-yl(methyl)amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)C(C)CO |
| InChI | InChI=1S/C9H19NO3/c1-7(9(12)13-4)5-10(3)8(2)6-11/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | AWSAMGVBEOFRPI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |