C19H23F2NO4S2 — CID 10455448
3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propylsulfanyl]propanoic acid (PubChem CID 10455448) has the molecular formula C19H23F2NO4S2 and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propylsulfanyl]propanoic acid.
| Compound Name | 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10455448 |
| Molecular Formula | C19H23F2NO4S2 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCCN1C(=O)SCC1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C19H23F2NO4S2/c20-19(21,14-5-2-1-3-6-14)16(23)8-7-15-13-28-18(26)22(15)10-4-11-27-12-9-17(24)25/h1-3,5-8,15-16,23H,4,9-13H2,(H,24,25)/b8-7+ |
| InChIKey | QEEKCBSQISJAIE-BQYQJAHWSA-N |
| XLogP | 3.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|