C23H20N4O3S — CID 10455506
(3Z,6Z)-3-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]-6-(1,3-thiazol-2-ylmethylidene)piperazine-2,5-dione (PubChem CID 10455506) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is (3Z,6Z)-3-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]-6-(1,3-thiazol-2-ylmethylidene)piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]-6-(1,3-thiazol-2-ylmethylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 10455506 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (3Z,6Z)-3-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]-6-(1,3-thiazol-2-ylmethylidene)piperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C\c2nccs2)c(=O)[nH]/c1=C\c1ccc(OCCCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c28-22-19(26-23(29)20(27-22)14-21-25-10-12-31-21)13-16-5-7-18(8-6-16)30-11-2-4-17-3-1-9-24-15-17/h1,3,5-10,12-15H,2,4,11H2,(H,26,29)(H,27,28)/b19-13-,20-14- |
| InChIKey | KSNMKXIQIDGPRF-AXPXABNXSA-N |
| XLogP | 1.58 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|