About N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine
N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine (PubChem CID 104555303) has the molecular formula C11H13BrN2S
and a molecular weight of 285.21 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine |
| PubChem CID | 104555303 |
| Molecular Formula | C11H13BrN2S |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine |
| SMILES | CC(CBr)N(C)c1nccc2sccc12 |
| InChI | InChI=1S/C11H13BrN2S/c1-8(7-12)14(2)11-9-4-6-15-10(9)3-5-13-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | WOGABKWGTTZEGB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine?
The IUPAC name of N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine (CID 104555303) is N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine?
The canonical SMILES for N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine is CC(CBr)N(C)c1nccc2sccc12.
What is the InChIKey of N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine?
The InChIKey is WOGABKWGTTZEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2S/c1-8(7-12)14(2)11-9-4-6-15-10(9)3-5-13-11/h3-6,8H,7H2,1-2H3.
What are the key properties of N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine?
N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine has a molecular weight of 285.21 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-bromopropan-2-yl)-N-methylthieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 104555303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).