C24H30Cl2N2O — CID 10455544
2,2-bis(4-chlorophenyl)-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]acetamide (PubChem CID 10455544) has the molecular formula C24H30Cl2N2O and a molecular weight of 433.42 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2,2-bis(4-chlorophenyl)-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 10455544 |
| Molecular Formula | C24H30Cl2N2O |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC1CCCC(C)N1CCCNC(=O)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H30Cl2N2O/c1-17-5-3-6-18(2)28(17)16-4-15-27-24(29)23(19-7-11-21(25)12-8-19)20-9-13-22(26)14-10-20/h7-14,17-18,23H,3-6,15-16H2,1-2H3,(H,27,29) |
| InChIKey | LSXRBLCFKKVJAF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|