C10H16ClN3O — CID 104555901
N-(1-chloropropan-2-yl)-N,2,5-trimethylpyrazole-3-carboxamide (PubChem CID 104555901) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N,2,5-trimethylpyrazole-3-carboxamide.
| Compound Name | N-(1-chloropropan-2-yl)-N,2,5-trimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 104555901 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N,2,5-trimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(C)CCl)n(C)n1 |
| InChI | InChI=1S/C10H16ClN3O/c1-7-5-9(14(4)12-7)10(15)13(3)8(2)6-11/h5,8H,6H2,1-4H3 |
| InChIKey | RQZPFPIUIJCMDV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|