C24H42N2O3Si — CID 10455610
2-[[(2R,3S)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]amino]ethyl N,N-di(propan-2-yl)carbamate (PubChem CID 10455610) has the molecular formula C24H42N2O3Si and a molecular weight of 434.70 g/mol. Its IUPAC name is 2-[[(2R,3S)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]amino]ethyl N,N-di(propan-2-yl)carbamate.
| Compound Name | 2-[[(2R,3S)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]amino]ethyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 10455610 |
| Molecular Formula | C24H42N2O3Si |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-[[(2R,3S)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]amino]ethyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)[C@@H]([C@H](C)C(=O)NCCOC(=O)N(C(C)C)C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H42N2O3Si/c1-17(2)22(30(8,9)21-13-11-10-12-14-21)20(7)23(27)25-15-16-29-24(28)26(18(3)4)19(5)6/h10-14,17-20,22H,15-16H2,1-9H3,(H,25,27)/t20-,22-/m0/s1 |
| InChIKey | IJFVORRGNRVDGH-UNMCSNQZSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|