C13H18BrNO — CID 104556144
N-(1-bromopropan-2-yl)-N,2,3-trimethylbenzamide (PubChem CID 104556144) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N,2,3-trimethylbenzamide.
| Compound Name | N-(1-bromopropan-2-yl)-N,2,3-trimethylbenzamide |
|---|---|
| PubChem CID | 104556144 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N,2,3-trimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C(C)CBr)c1C |
| InChI | InChI=1S/C13H18BrNO/c1-9-6-5-7-12(11(9)3)13(16)15(4)10(2)8-14/h5-7,10H,8H2,1-4H3 |
| InChIKey | LFXRJAYXUVAPAX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|