C25H28N2O5 — CID 10455690
[2-[benzyl(methyl)amino]cyclohexyl] (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (PubChem CID 10455690) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]cyclohexyl] (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate.
| Compound Name | [2-[benzyl(methyl)amino]cyclohexyl] (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 10455690 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [2-[benzyl(methyl)amino]cyclohexyl] (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| SMILES | CC(=O)/C(=C\c1cccc([N+](=O)[O-])c1)C(=O)OC1CCCCC1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O5/c1-18(28)22(16-20-11-8-12-21(15-20)27(30)31)25(29)32-24-14-7-6-13-23(24)26(2)17-19-9-4-3-5-10-19/h3-5,8-12,15-16,23-24H,6-7,13-14,17H2,1-2H3/b22-16+ |
| InChIKey | NQQIJDBLZHDALG-CJLVFECKSA-N |
| XLogP | 4.55 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|