About 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol (PubChem CID 104557030) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol |
| PubChem CID | 104557030 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol |
| SMILES | CC(CO)N(C)c1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C10H15N5O/c1-7(6-16)14(2)10-9-12-3-4-15(9)5-8(11)13-10/h3-5,7,16H,6,11H2,1-2H3 |
| InChIKey | XMMDFIFVPQSOIO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol?
The IUPAC name of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol (CID 104557030) is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol.
What is the SMILES notation for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol?
The canonical SMILES for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol is CC(CO)N(C)c1nc(N)cn2ccnc12.
What is the InChIKey of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol?
The InChIKey is XMMDFIFVPQSOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c1-7(6-16)14(2)10-9-12-3-4-15(9)5-8(11)13-10/h3-5,7,16H,6,11H2,1-2H3.
What are the key properties of 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol?
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol has a molecular weight of 221.26 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-methylamino]propan-1-ol is sourced from PubChem (CID 104557030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).