C15H19NO4 — CID 104557211
2-(4-methoxybutanoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid (PubChem CID 104557211) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(4-methoxybutanoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid.
| Compound Name | 2-(4-methoxybutanoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 104557211 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(4-methoxybutanoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid |
| SMILES | COCCCC(=O)N1CCc2c(cccc2C(=O)O)C1 |
| InChI | InChI=1S/C15H19NO4/c1-20-9-3-6-14(17)16-8-7-12-11(10-16)4-2-5-13(12)15(18)19/h2,4-5H,3,6-10H2,1H3,(H,18,19) |
| InChIKey | HGJFSUVOEHWTFF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|