C18H19N3 — CID 104557786
5-(1,5-dimethylbenzimidazol-2-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 104557786) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-(1,5-dimethylbenzimidazol-2-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-(1,5-dimethylbenzimidazol-2-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 104557786 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 5-(1,5-dimethylbenzimidazol-2-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc2c(c1)nc(-c1cccc3c1CCNC3)n2C |
| InChI | InChI=1S/C18H19N3/c1-12-6-7-17-16(10-12)20-18(21(17)2)15-5-3-4-13-11-19-9-8-14(13)15/h3-7,10,19H,8-9,11H2,1-2H3 |
| InChIKey | VVMZGETWTMTBGV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|