C16H20N2O — CID 104557956
N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide (PubChem CID 104557956) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide.
| Compound Name | N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 104557956 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C16H20N2O/c1-3-10-18(11-4-2)16(19)15-7-5-6-13-12-17-9-8-14(13)15/h3-7,17H,1-2,8-12H2 |
| InChIKey | FJXIFPOPLKQGIV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|