C16H16ClN3O — CID 104558700
N-(2-chloro-4-methyl-3-pyridinyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide (PubChem CID 104558700) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is N-(2-chloro-4-methyl-3-pyridinyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide.
| Compound Name | N-(2-chloro-4-methyl-3-pyridinyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 104558700 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-chloro-4-methyl-3-pyridinyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
| SMILES | Cc1ccnc(Cl)c1NC(=O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C16H16ClN3O/c1-10-5-8-19-15(17)14(10)20-16(21)13-4-2-3-11-9-18-7-6-12(11)13/h2-5,8,18H,6-7,9H2,1H3,(H,20,21) |
| InChIKey | MPQCNRQYDQYWQQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|