C18H27NO2 — CID 104559199
octan-2-yl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate (PubChem CID 104559199) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is octan-2-yl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate.
| Compound Name | octan-2-yl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate |
|---|---|
| PubChem CID | 104559199 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | octan-2-yl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate |
| SMILES | CCCCCCC(C)OC(=O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C18H27NO2/c1-3-4-5-6-8-14(2)21-18(20)17-10-7-9-15-13-19-12-11-16(15)17/h7,9-10,14,19H,3-6,8,11-13H2,1-2H3 |
| InChIKey | GMDFWXMXAXDUKF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|