About tributyl(undeca-2,3-dien-2-yl)stannane
tributyl(undeca-2,3-dien-2-yl)stannane (PubChem CID 10455956) has the molecular formula C23H46Sn
and a molecular weight of 441.33 g/mol. Its IUPAC name is tributyl(undeca-2,3-dien-2-yl)stannane.
Molecular Properties
| Compound Name | tributyl(undeca-2,3-dien-2-yl)stannane |
| PubChem CID | 10455956 |
| Molecular Formula | C23H46Sn |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | tributyl(undeca-2,3-dien-2-yl)stannane |
| SMILES | CCCCCCCC=C=C(C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H19.3C4H9.Sn/c1-3-5-7-9-11-10-8-6-4-2;3*1-3-4-2;/h8H,3,5,7,9-11H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | NCMFKWFPKCNMGC-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tributyl(undeca-2,3-dien-2-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(undeca-2,3-dien-2-yl)stannane?
The IUPAC name of tributyl(undeca-2,3-dien-2-yl)stannane (CID 10455956) is tributyl(undeca-2,3-dien-2-yl)stannane.
What is the SMILES notation for tributyl(undeca-2,3-dien-2-yl)stannane?
The canonical SMILES for tributyl(undeca-2,3-dien-2-yl)stannane is CCCCCCCC=C=C(C)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl(undeca-2,3-dien-2-yl)stannane?
The InChIKey is NCMFKWFPKCNMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19.3C4H9.Sn/c1-3-5-7-9-11-10-8-6-4-2;3*1-3-4-2;/h8H,3,5,7,9-11H2,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl(undeca-2,3-dien-2-yl)stannane?
tributyl(undeca-2,3-dien-2-yl)stannane has a molecular weight of 441.33 g/mol, XLogP of 8.84, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(undeca-2,3-dien-2-yl)stannane is sourced from PubChem (CID 10455956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).