C13H24BrF3O4 — CID 104561217
1-[2-[2-[2-(2-bromo-3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]butane (PubChem CID 104561217) has the molecular formula C13H24BrF3O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-bromo-3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]butane.
| Compound Name | 1-[2-[2-[2-(2-bromo-3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]butane |
|---|---|
| PubChem CID | 104561217 |
| Molecular Formula | C13H24BrF3O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-[2-[2-[2-(2-bromo-3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]butane |
| SMILES | CCCCOCCOCCOCCOCC(Br)C(F)(F)F |
| InChI | InChI=1S/C13H24BrF3O4/c1-2-3-4-18-5-6-19-7-8-20-9-10-21-11-12(14)13(15,16)17/h12H,2-11H2,1H3 |
| InChIKey | NISRXAWWKBJQHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|