C11H18N2O3 — CID 104562052
5-[2-(2-methoxyethoxy)ethoxymethyl]pyridin-2-amine (PubChem CID 104562052) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxy)ethoxymethyl]pyridin-2-amine.
| Compound Name | 5-[2-(2-methoxyethoxy)ethoxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 104562052 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-[2-(2-methoxyethoxy)ethoxymethyl]pyridin-2-amine |
| SMILES | COCCOCCOCc1ccc(N)nc1 |
| InChI | InChI=1S/C11H18N2O3/c1-14-4-5-15-6-7-16-9-10-2-3-11(12)13-8-10/h2-3,8H,4-7,9H2,1H3,(H2,12,13) |
| InChIKey | SKXZJGDCLRIPCI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|