C12H28N2O3 — CID 104562097
1-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 104562097) has the molecular formula C12H28N2O3 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 1-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 104562097 |
| Molecular Formula | C12H28N2O3 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | COCCOCCOCCNCC(C)N(C)C |
| InChI | InChI=1S/C12H28N2O3/c1-12(14(2)3)11-13-5-6-16-9-10-17-8-7-15-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | DUFSQSCIWDHSNY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|