C23H32N2O5S — CID 10456329
8-[(4-methoxyphenyl)sulfonylamino]-4-(3-pyridin-3-ylpropyl)octanoic acid (PubChem CID 10456329) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)sulfonylamino]-4-(3-pyridin-3-ylpropyl)octanoic acid.
| Compound Name | 8-[(4-methoxyphenyl)sulfonylamino]-4-(3-pyridin-3-ylpropyl)octanoic acid |
|---|---|
| PubChem CID | 10456329 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 8-[(4-methoxyphenyl)sulfonylamino]-4-(3-pyridin-3-ylpropyl)octanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NCCCCC(CCCc2cccnc2)CCC(=O)O)cc1 |
| InChI | InChI=1S/C23H32N2O5S/c1-30-21-11-13-22(14-12-21)31(28,29)25-17-3-2-6-19(10-15-23(26)27)7-4-8-20-9-5-16-24-18-20/h5,9,11-14,16,18-19,25H,2-4,6-8,10,15,17H2,1H3,(H,26,27) |
| InChIKey | DGVWPPLXIBZQHJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|