C16H34N2O3 — CID 104563816
N'-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-cyclopropyl-N'-methylethane-1,2-diamine (PubChem CID 104563816) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is N'-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-cyclopropyl-N'-methylethane-1,2-diamine.
| Compound Name | N'-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-cyclopropyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104563816 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | N'-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N-cyclopropyl-N'-methylethane-1,2-diamine |
| SMILES | CCCCOCCOCCOCCN(C)CCNC1CC1 |
| InChI | InChI=1S/C16H34N2O3/c1-3-4-10-19-12-14-21-15-13-20-11-9-18(2)8-7-17-16-5-6-16/h16-17H,3-15H2,1-2H3 |
| InChIKey | WDLDWLRRMQLEMH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|